nohomework33 nohomework33

04-02-2021
Mathematics

contestada

✨Could ✨someone✨help ✨me ✨with ✨this? ✨It ✨would ✨be ✨much ✨appreciated✨

Could someonehelp me with this It would be much appreciated class=

Respuesta :

Аноним Аноним

04-02-2021

Answer:

B

Step-by-step explanation:

2x-5y=-25

5y=2x+25

y=2/5 x+5

Answer Link

Аноним Аноним

04-02-2021

Answer:

B. y = 2/5x + 5

Step-by-step explanation:

Answer Link

Otras preguntas

A 4. 0 g sample of ra-226 decays to 1. 0 g. if the half-life of ra-226 is 1620 years, how much time has elapsed?

What is the converse of the conditional statement? If x is even, then x + 1 is odd. O If x is not even, then x + 1 is not odd. O If x + 1 is odd, then x is even

If air is flowing parallel to straight isobars, what horizontal forces are acting on the air?

What is mommy’s reaction to the children leaving for el otro lado

In order for you to use the goodnees-of-fit test, the test of independence, or the test of homogeneity, the expected frequencies for each cell needs to be at le

True or false: simpson’s paradox occurs whenever including a lurking variable causes you to rethink the direction of an association

Large organizations often hire lobbyists with experience in regulatory agencies because the lobbyists have?

Draw the products formed when each ester is treated with lithium hydroxide and water. ch3ch2ch(ch3)oc=och(ch3)2−→−−h2olioh

how is that velocity got like this? pls explain

All else being equal, what will happen to the denominator of the f ratio if the between-group variances are increased?